C15H20F2N2O2 — CID 164593620
ethyl (Z)-6-(3-amino-2,6-difluorophenyl)-4-(methylamino)hex-3-enoate (PubChem CID 164593620) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is ethyl (Z)-6-(3-amino-2,6-difluorophenyl)-4-(methylamino)hex-3-enoate.
| Compound Name | ethyl (Z)-6-(3-amino-2,6-difluorophenyl)-4-(methylamino)hex-3-enoate |
|---|---|
| PubChem CID | 164593620 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | ethyl (Z)-6-(3-amino-2,6-difluorophenyl)-4-(methylamino)hex-3-enoate |
| SMILES | CCOC(=O)C/C=C(/CCc1c(F)ccc(N)c1F)NC |
| InChI | InChI=1S/C15H20F2N2O2/c1-3-21-14(20)9-5-10(19-2)4-6-11-12(16)7-8-13(18)15(11)17/h5,7-8,19H,3-4,6,9,18H2,1-2H3/b10-5- |
| InChIKey | FWJKROABADIHPV-YHYXMXQVSA-N |
| XLogP | 2.54 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|