C24H14F5N3O — CID 164593827
1-[6-[3-[3-ethynyl-5-(trifluoromethyl)anilino]-2,6-difluorophenyl]imidazo[1,5-a]pyridin-1-yl]ethanone (PubChem CID 164593827) has the molecular formula C24H14F5N3O and a molecular weight of 455.39 g/mol. Its IUPAC name is 1-[6-[3-[3-ethynyl-5-(trifluoromethyl)anilino]-2,6-difluorophenyl]imidazo[1,5-a]pyridin-1-yl]ethanone.
| Compound Name | 1-[6-[3-[3-ethynyl-5-(trifluoromethyl)anilino]-2,6-difluorophenyl]imidazo[1,5-a]pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 164593827 |
| Molecular Formula | C24H14F5N3O |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 1-[6-[3-[3-ethynyl-5-(trifluoromethyl)anilino]-2,6-difluorophenyl]imidazo[1,5-a]pyridin-1-yl]ethanone |
| SMILES | C#Cc1cc(Nc2ccc(F)c(-c3ccc4c(C(C)=O)ncn4c3)c2F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H14F5N3O/c1-3-14-8-16(24(27,28)29)10-17(9-14)31-19-6-5-18(25)21(22(19)26)15-4-7-20-23(13(2)33)30-12-32(20)11-15/h1,4-12,31H,2H3 |
| InChIKey | KUMUHYQKLYCTKS-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|