C13H7F6NO2S — CID 23456886
4-[3,5-bis(trifluoromethyl)anilino]thiophene-3-carboxylic acid (PubChem CID 23456886) has the molecular formula C13H7F6NO2S and a molecular weight of 355.26 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)anilino]thiophene-3-carboxylic acid.
| Compound Name | 4-[3,5-bis(trifluoromethyl)anilino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 23456886 |
| Molecular Formula | C13H7F6NO2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)anilino]thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1cscc1Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H7F6NO2S/c14-12(15,16)6-1-7(13(17,18)19)3-8(2-6)20-10-5-23-4-9(10)11(21)22/h1-5,20H,(H,21,22) |
| InChIKey | AXDCPVDHIQVEQM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |