C21H18F3NO2 — CID 171358053
2-[3-(2-cyclopentylethynyl)-5-(trifluoromethyl)anilino]benzoic acid (PubChem CID 171358053) has the molecular formula C21H18F3NO2 and a molecular weight of 373.37 g/mol. Its IUPAC name is 2-[3-(2-cyclopentylethynyl)-5-(trifluoromethyl)anilino]benzoic acid.
| Compound Name | 2-[3-(2-cyclopentylethynyl)-5-(trifluoromethyl)anilino]benzoic acid |
|---|---|
| PubChem CID | 171358053 |
| Molecular Formula | C21H18F3NO2 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-[3-(2-cyclopentylethynyl)-5-(trifluoromethyl)anilino]benzoic acid |
| SMILES | O=C(O)c1ccccc1Nc1cc(C#CC2CCCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F3NO2/c22-21(23,24)16-11-15(10-9-14-5-1-2-6-14)12-17(13-16)25-19-8-4-3-7-18(19)20(26)27/h3-4,7-8,11-14,25H,1-2,5-6H2,(H,26,27) |
| InChIKey | OLEOWNOUALXQNA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|