C21H27NO2 — CID 139034527
4-tert-butyl-2-(3-tert-butylanilino)benzoic acid (PubChem CID 139034527) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 4-tert-butyl-2-(3-tert-butylanilino)benzoic acid.
| Compound Name | 4-tert-butyl-2-(3-tert-butylanilino)benzoic acid |
|---|---|
| PubChem CID | 139034527 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 4-tert-butyl-2-(3-tert-butylanilino)benzoic acid |
| SMILES | CC(C)(C)c1cccc(Nc2cc(C(C)(C)C)ccc2C(=O)O)c1 |
| InChI | InChI=1S/C21H27NO2/c1-20(2,3)14-8-7-9-16(12-14)22-18-13-15(21(4,5)6)10-11-17(18)19(23)24/h7-13,22H,1-6H3,(H,23,24) |
| InChIKey | POUKUSAOITZZGR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |