C16H23NO3 — CID 59808561
4-tert-butyl-2-(3-methylbutanoylamino)benzoic acid (PubChem CID 59808561) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 4-tert-butyl-2-(3-methylbutanoylamino)benzoic acid.
| Compound Name | 4-tert-butyl-2-(3-methylbutanoylamino)benzoic acid |
|---|---|
| PubChem CID | 59808561 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 4-tert-butyl-2-(3-methylbutanoylamino)benzoic acid |
| SMILES | CC(C)CC(=O)Nc1cc(C(C)(C)C)ccc1C(=O)O |
| InChI | InChI=1S/C16H23NO3/c1-10(2)8-14(18)17-13-9-11(16(3,4)5)6-7-12(13)15(19)20/h6-7,9-10H,8H2,1-5H3,(H,17,18)(H,19,20) |
| InChIKey | YZRJRBPYQHMCCO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |