C23H22FNO2 — CID 68962853
4-(4-tert-butylphenyl)-2-(4-fluoroanilino)benzoic acid (PubChem CID 68962853) has the molecular formula C23H22FNO2 and a molecular weight of 363.43 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-2-(4-fluoroanilino)benzoic acid.
| Compound Name | 4-(4-tert-butylphenyl)-2-(4-fluoroanilino)benzoic acid |
|---|---|
| PubChem CID | 68962853 |
| Molecular Formula | C23H22FNO2 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-(4-tert-butylphenyl)-2-(4-fluoroanilino)benzoic acid |
| SMILES | CC(C)(C)c1ccc(-c2ccc(C(=O)O)c(Nc3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C23H22FNO2/c1-23(2,3)17-7-4-15(5-8-17)16-6-13-20(22(26)27)21(14-16)25-19-11-9-18(24)10-12-19/h4-14,25H,1-3H3,(H,26,27) |
| InChIKey | CSIWSRRQZSAANH-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |