C30H37F2N5S — CID 164594527
N-[(3E)-3-[(5S)-5-[3-[[(2-ethyl-5-ethynyl-3-pyridinyl)-dimethylidene-λ6-sulfanyl]amino]-2,6-difluorophenyl]-1-methylpiperidin-2-ylidene]but-1-en-2-yl]-N'-methylethanimidamide (PubChem CID 164594527) has the molecular formula C30H37F2N5S and a molecular weight of 537.72 g/mol. Its IUPAC name is N-[(3E)-3-[(5S)-5-[3-[[(2-ethyl-5-ethynyl-3-pyridinyl)-dimethylidene-λ6-sulfanyl]amino]-2,6-difluorophenyl]-1-methylpiperidin-2-ylidene]but-1-en-2-yl]-N'-methylethanimidamide.
| Compound Name | N-[(3E)-3-[(5S)-5-[3-[[(2-ethyl-5-ethynyl-3-pyridinyl)-dimethylidene-λ6-sulfanyl]amino]-2,6-difluorophenyl]-1-methylpiperidin-2-ylidene]but-1-en-2-yl]-N'-methylethanimidamide |
|---|---|
| PubChem CID | 164594527 |
| Molecular Formula | C30H37F2N5S |
| Molecular Weight | 537.72 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | N-[(3E)-3-[(5S)-5-[3-[[(2-ethyl-5-ethynyl-3-pyridinyl)-dimethylidene-λ6-sulfanyl]amino]-2,6-difluorophenyl]-1-methylpiperidin-2-ylidene]but-1-en-2-yl]-N'-methylethanimidamide |
| SMILES | C#Cc1cnc(CC)c(S(=C)(=C)Nc2ccc(F)c([C@@H]3CC/C(=C(/C)C(=C)N/C(C)=N/C)N(C)C3)c2F)c1 |
| InChI | InChI=1S/C30H37F2N5S/c1-10-22-16-28(25(11-2)34-17-22)38(8,9)36-26-14-13-24(31)29(30(26)32)23-12-15-27(37(7)18-23)19(3)20(4)35-21(5)33-6/h1,13-14,16-17,23,36H,4,8-9,11-12,15,18H2,2-3,5-7H3,(H,33,35)/b27-19+/t23-/m1/s1 |
| InChIKey | DSWWRICYKNNKNV-LRRHNFBNSA-N |
| XLogP | 6.19 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.72 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|