C27H29FN4O3 — CID 152622724
6-[3-(3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl)propoxy]-2-(3-ethynyl-4-fluorophenyl)-7-methoxyquinazolin-4-amine (PubChem CID 152622724) has the molecular formula C27H29FN4O3 and a molecular weight of 476.55 g/mol. Its IUPAC name is 6-[3-(3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl)propoxy]-2-(3-ethynyl-4-fluorophenyl)-7-methoxyquinazolin-4-amine.
| Compound Name | 6-[3-(3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl)propoxy]-2-(3-ethynyl-4-fluorophenyl)-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 152622724 |
| Molecular Formula | C27H29FN4O3 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 6-[3-(3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl)propoxy]-2-(3-ethynyl-4-fluorophenyl)-7-methoxyquinazolin-4-amine |
| SMILES | C#Cc1cc(-c2nc(N)c3cc(OCCCN4CCC5COCC5C4)c(OC)cc3n2)ccc1F |
| InChI | InChI=1S/C27H29FN4O3/c1-3-17-11-18(5-6-22(17)28)27-30-23-13-24(33-2)25(12-21(23)26(29)31-27)35-10-4-8-32-9-7-19-15-34-16-20(19)14-32/h1,5-6,11-13,19-20H,4,7-10,14-16H2,2H3,(H2,29,30,31) |
| InChIKey | ZBWFRXUQCJTXAK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 82.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|