C29H35BrFN3O3 — CID 123645345
9-[3-(3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl)propoxy]-N-(4-bromo-2-fluorophenyl)-8-methoxy-6-methyl-5,6-dihydro-2-benzazocin-1-amine (PubChem CID 123645345) has the molecular formula C29H35BrFN3O3 and a molecular weight of 572.52 g/mol. Its IUPAC name is 9-[3-(3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl)propoxy]-N-(4-bromo-2-fluorophenyl)-8-methoxy-6-methyl-5,6-dihydro-2-benzazocin-1-amine.
| Compound Name | 9-[3-(3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl)propoxy]-N-(4-bromo-2-fluorophenyl)-8-methoxy-6-methyl-5,6-dihydro-2-benzazocin-1-amine |
|---|---|
| PubChem CID | 123645345 |
| Molecular Formula | C29H35BrFN3O3 |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 9-[3-(3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl)propoxy]-N-(4-bromo-2-fluorophenyl)-8-methoxy-6-methyl-5,6-dihydro-2-benzazocin-1-amine |
| SMILES | COc1cc2c(cc1OCCCN1CCC3COCC3C1)/C(Nc1ccc(Br)cc1F)=N\C=CCC2C |
| InChI | InChI=1S/C29H35BrFN3O3/c1-19-5-3-9-32-29(33-26-7-6-22(30)13-25(26)31)24-15-28(27(35-2)14-23(19)24)37-12-4-10-34-11-8-20-17-36-18-21(20)16-34/h3,6-7,9,13-15,19-21H,4-5,8,10-12,16-18H2,1-2H3,(H,32,33) |
| InChIKey | BVGAAPGZVYSKPL-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|