C27H33FN6O2 — CID 123278642
N-(4-fluorophenyl)-9-[3-(3-imino-4-methanimidoylpiperazin-1-yl)propoxy]-8-methoxy-6-methyl-5,6-dihydro-2-benzazocin-1-amine (PubChem CID 123278642) has the molecular formula C27H33FN6O2 and a molecular weight of 492.60 g/mol. Its IUPAC name is N-(4-fluorophenyl)-9-[3-(3-imino-4-methanimidoylpiperazin-1-yl)propoxy]-8-methoxy-6-methyl-5,6-dihydro-2-benzazocin-1-amine.
| Compound Name | N-(4-fluorophenyl)-9-[3-(3-imino-4-methanimidoylpiperazin-1-yl)propoxy]-8-methoxy-6-methyl-5,6-dihydro-2-benzazocin-1-amine |
|---|---|
| PubChem CID | 123278642 |
| Molecular Formula | C27H33FN6O2 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | N-(4-fluorophenyl)-9-[3-(3-imino-4-methanimidoylpiperazin-1-yl)propoxy]-8-methoxy-6-methyl-5,6-dihydro-2-benzazocin-1-amine |
| SMILES | [H]/N=C/N1CCN(CCCOc2cc3c(cc2OC)C(C)CC=C/N=C\3Nc2ccc(F)cc2)C/C1=N\[H] |
| InChI | InChI=1S/C27H33FN6O2/c1-19-5-3-10-31-27(32-21-8-6-20(28)7-9-21)23-16-25(24(35-2)15-22(19)23)36-14-4-11-33-12-13-34(18-29)26(30)17-33/h3,6-10,15-16,18-19,29-30H,4-5,11-14,17H2,1-2H3,(H,31,32)/b10-3?,29-18+,30-26+ |
| InChIKey | ZTGSSSAIFUUKNI-QYBSDWHQSA-N |
| XLogP | 4.68 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|