C37H49N3O3 — CID 142235056
N-[4-[7-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-4-propan-2-ylaniline;ethane (PubChem CID 142235056) has the molecular formula C37H49N3O3 and a molecular weight of 583.82 g/mol. Its IUPAC name is N-[4-[7-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-4-propan-2-ylaniline;ethane.
| Compound Name | N-[4-[7-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-4-propan-2-ylaniline;ethane |
|---|---|
| PubChem CID | 142235056 |
| Molecular Formula | C37H49N3O3 |
| Molecular Weight | 583.82 g/mol |
| Exact Mass | 583.38 |
| IUPAC Name | N-[4-[7-[3-(3,5-dimethylpiperidin-1-yl)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]-4-propan-2-ylaniline;ethane |
| SMILES | CC.COc1cc2c(Oc3ccc(Nc4ccc(C(C)C)cc4)cc3)ccnc2cc1OCCCN1CC(C)CC(C)C1 |
| InChI | InChI=1S/C35H43N3O3.C2H6/c1-24(2)27-7-9-28(10-8-27)37-29-11-13-30(14-12-29)41-33-15-16-36-32-21-35(34(39-5)20-31(32)33)40-18-6-17-38-22-25(3)19-26(4)23-38;1-2/h7-16,20-21,24-26,37H,6,17-19,22-23H2,1-5H3;1-2H3 |
| InChIKey | YKSPSZMQKJRLQV-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.82 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|