C17H25N3 — CID 164594772
N-[(3E)-3-(1-ethenyl-5-methyl-2-pyridinylidene)but-1-en-2-yl]-N',2-dimethylpropanimidamide (PubChem CID 164594772) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is N-[(3E)-3-(1-ethenyl-5-methyl-2-pyridinylidene)but-1-en-2-yl]-N',2-dimethylpropanimidamide.
| Compound Name | N-[(3E)-3-(1-ethenyl-5-methyl-2-pyridinylidene)but-1-en-2-yl]-N',2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 164594772 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | N-[(3E)-3-(1-ethenyl-5-methyl-2-pyridinylidene)but-1-en-2-yl]-N',2-dimethylpropanimidamide |
| SMILES | C=CN1C=C(C)C=C/C1=C(/C)C(=C)N/C(=N/C)C(C)C |
| InChI | InChI=1S/C17H25N3/c1-8-20-11-13(4)9-10-16(20)14(5)15(6)19-17(18-7)12(2)3/h8-12H,1,6H2,2-5,7H3,(H,18,19)/b16-14+ |
| InChIKey | WMYYZRMPDJZLGG-JQIJEIRASA-N |
| XLogP | 3.97 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|