C23H38O2 — CID 164595219
(Z)-7-ethenyl-3,3,12,12-tetramethyl-8-[(Z)-prop-1-enyl]tetradec-7-ene-2,13-dione (PubChem CID 164595219) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is (Z)-7-ethenyl-3,3,12,12-tetramethyl-8-[(Z)-prop-1-enyl]tetradec-7-ene-2,13-dione.
| Compound Name | (Z)-7-ethenyl-3,3,12,12-tetramethyl-8-[(Z)-prop-1-enyl]tetradec-7-ene-2,13-dione |
|---|---|
| PubChem CID | 164595219 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | (Z)-7-ethenyl-3,3,12,12-tetramethyl-8-[(Z)-prop-1-enyl]tetradec-7-ene-2,13-dione |
| SMILES | C=C/C(CCCC(C)(C)C(C)=O)=C(\C=C/C)CCCC(C)(C)C(C)=O |
| InChI | InChI=1S/C23H38O2/c1-9-13-21(15-12-17-23(7,8)19(4)25)20(10-2)14-11-16-22(5,6)18(3)24/h9-10,13H,2,11-12,14-17H2,1,3-8H3/b13-9-,21-20- |
| InChIKey | DHJSUFHXQQAKKA-RWJRDFFHSA-N |
| XLogP | 6.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|