C14H19FN2 — CID 164596000
1-[(2Z,4Z)-2-ethenyl-3-fluorohexa-2,4-dienyl]-4-propan-2-ylimidazole (PubChem CID 164596000) has the molecular formula C14H19FN2 and a molecular weight of 234.32 g/mol. Its IUPAC name is 1-[(2Z,4Z)-2-ethenyl-3-fluorohexa-2,4-dienyl]-4-propan-2-ylimidazole.
| Compound Name | 1-[(2Z,4Z)-2-ethenyl-3-fluorohexa-2,4-dienyl]-4-propan-2-ylimidazole |
|---|---|
| PubChem CID | 164596000 |
| Molecular Formula | C14H19FN2 |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 1-[(2Z,4Z)-2-ethenyl-3-fluorohexa-2,4-dienyl]-4-propan-2-ylimidazole |
| SMILES | C=C/C(Cn1cnc(C(C)C)c1)=C(F)\C=C/C |
| InChI | InChI=1S/C14H19FN2/c1-5-7-13(15)12(6-2)8-17-9-14(11(3)4)16-10-17/h5-7,9-11H,2,8H2,1,3-4H3/b7-5-,13-12- |
| InChIKey | SMXJPMXSCIOWIP-TXTXDJJGSA-N |
| XLogP | 3.99 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|