C20H22N4O3 — CID 164596399
3-[3-methyl-4-[3-[(3R)-pyrrolidin-3-yl]oxyprop-1-ynyl]indazol-1-yl]piperidine-2,6-dione (PubChem CID 164596399) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 3-[3-methyl-4-[3-[(3R)-pyrrolidin-3-yl]oxyprop-1-ynyl]indazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-methyl-4-[3-[(3R)-pyrrolidin-3-yl]oxyprop-1-ynyl]indazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164596399 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 3-[3-methyl-4-[3-[(3R)-pyrrolidin-3-yl]oxyprop-1-ynyl]indazol-1-yl]piperidine-2,6-dione |
| SMILES | Cc1nn(C2CCC(=O)NC2=O)c2cccc(C#CCO[C@@H]3CCNC3)c12 |
| InChI | InChI=1S/C20H22N4O3/c1-13-19-14(5-3-11-27-15-9-10-21-12-15)4-2-6-16(19)24(23-13)17-7-8-18(25)22-20(17)26/h2,4,6,15,17,21H,7-12H2,1H3,(H,22,25,26)/t15-,17?/m1/s1 |
| InChIKey | SAODERWDNAAEIZ-LDCVWXEPSA-N |
| XLogP | 1.05 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|