C24H29F3N4O6 — CID 175469479
3-[3-methyl-4-(3-piperidin-4-yloxycyclobutyl)oxyindazol-1-yl]piperidine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 175469479) has the molecular formula C24H29F3N4O6 and a molecular weight of 526.51 g/mol. Its IUPAC name is 3-[3-methyl-4-(3-piperidin-4-yloxycyclobutyl)oxyindazol-1-yl]piperidine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[3-methyl-4-(3-piperidin-4-yloxycyclobutyl)oxyindazol-1-yl]piperidine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175469479 |
| Molecular Formula | C24H29F3N4O6 |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 3-[3-methyl-4-(3-piperidin-4-yloxycyclobutyl)oxyindazol-1-yl]piperidine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nn(C2CCC(=O)NC2=O)c2cccc(OC3CC(OC4CCNCC4)C3)c12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H28N4O4.C2HF3O2/c1-13-21-17(26(25-13)18-5-6-20(27)24-22(18)28)3-2-4-19(21)30-16-11-15(12-16)29-14-7-9-23-10-8-14;3-2(4,5)1(6)7/h2-4,14-16,18,23H,5-12H2,1H3,(H,24,27,28);(H,6,7) |
| InChIKey | GGBVOJDQYSFRSP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|