C15H16FN3O2 — CID 176931807
3-(4-ethyl-5-fluoro-3-methylindazol-1-yl)piperidine-2,6-dione (PubChem CID 176931807) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is 3-(4-ethyl-5-fluoro-3-methylindazol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(4-ethyl-5-fluoro-3-methylindazol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 176931807 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3-(4-ethyl-5-fluoro-3-methylindazol-1-yl)piperidine-2,6-dione |
| SMILES | CCc1c(F)ccc2c1c(C)nn2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C15H16FN3O2/c1-3-9-10(16)4-5-11-14(9)8(2)18-19(11)12-6-7-13(20)17-15(12)21/h4-5,12H,3,6-7H2,1-2H3,(H,17,20,21) |
| InChIKey | IRRWEACYQQZVFR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|