C16H18FIN3O2- — CID 176933551
3-(5-fluoro-3-methyl-4-propan-2-ylindazol-1-yl)iodanuidylpiperidine-2,6-dione (PubChem CID 176933551) has the molecular formula C16H18FIN3O2- and a molecular weight of 430.24 g/mol. Its IUPAC name is 3-(5-fluoro-3-methyl-4-propan-2-ylindazol-1-yl)iodanuidylpiperidine-2,6-dione.
| Compound Name | 3-(5-fluoro-3-methyl-4-propan-2-ylindazol-1-yl)iodanuidylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 176933551 |
| Molecular Formula | C16H18FIN3O2- |
| Molecular Weight | 430.24 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 3-(5-fluoro-3-methyl-4-propan-2-ylindazol-1-yl)iodanuidylpiperidine-2,6-dione |
| SMILES | Cc1nn([I-]C2CCC(=O)NC2=O)c2ccc(F)c(C(C)C)c12 |
| InChI | InChI=1S/C16H18FIN3O2/c1-8(2)14-10(17)4-6-12-15(14)9(3)20-21(12)18-11-5-7-13(22)19-16(11)23/h4,6,8,11H,5,7H2,1-3H3,(H,19,22,23)/q-1 |
| InChIKey | ACQYQFNVPOUOPO-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.24 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|