C20H29N7O3 — CID 164596630
8-amino-6-butoxy-3-[[6-[2-(dimethylamino)ethoxy]-3-pyridinyl]methyl]-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one (PubChem CID 164596630) has the molecular formula C20H29N7O3 and a molecular weight of 415.50 g/mol. Its IUPAC name is 8-amino-6-butoxy-3-[[6-[2-(dimethylamino)ethoxy]-3-pyridinyl]methyl]-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one.
| Compound Name | 8-amino-6-butoxy-3-[[6-[2-(dimethylamino)ethoxy]-3-pyridinyl]methyl]-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 164596630 |
| Molecular Formula | C20H29N7O3 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 8-amino-6-butoxy-3-[[6-[2-(dimethylamino)ethoxy]-3-pyridinyl]methyl]-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one |
| SMILES | CCCCOc1nc(N)c2c(n1)CN(Cc1ccc(OCCN(C)C)nc1)C(=O)N2 |
| InChI | InChI=1S/C20H29N7O3/c1-4-5-9-30-19-23-15-13-27(20(28)24-17(15)18(21)25-19)12-14-6-7-16(22-11-14)29-10-8-26(2)3/h6-7,11H,4-5,8-10,12-13H2,1-3H3,(H,24,28)(H2,21,23,25) |
| InChIKey | UMJQOMBINWFLEK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|