C22H27N7O2 — CID 167226517
8-amino-6-butoxy-3-[[4-(imidazol-1-ylmethyl)-3-methylphenyl]methyl]-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one (PubChem CID 167226517) has the molecular formula C22H27N7O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is 8-amino-6-butoxy-3-[[4-(imidazol-1-ylmethyl)-3-methylphenyl]methyl]-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one.
| Compound Name | 8-amino-6-butoxy-3-[[4-(imidazol-1-ylmethyl)-3-methylphenyl]methyl]-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 167226517 |
| Molecular Formula | C22H27N7O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 8-amino-6-butoxy-3-[[4-(imidazol-1-ylmethyl)-3-methylphenyl]methyl]-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one |
| SMILES | CCCCOc1nc(N)c2c(n1)CN(Cc1ccc(Cn3ccnc3)c(C)c1)C(=O)N2 |
| InChI | InChI=1S/C22H27N7O2/c1-3-4-9-31-21-25-18-13-29(22(30)26-19(18)20(23)27-21)11-16-5-6-17(15(2)10-16)12-28-8-7-24-14-28/h5-8,10,14H,3-4,9,11-13H2,1-2H3,(H,26,30)(H2,23,25,27) |
| InChIKey | ULZDEBMPXZAVOT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|