C24H26BrClFN5O4 — CID 164596902
tert-butyl (4R,7R,11R)-11-(aminomethyl)-17-bromo-18-chloro-16-fluoro-4-methyl-8-(oxomethylidene)-12-oxa-2,5,9,14-tetrazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(21),13,15,17,19-pentaene-5-carboxylate (PubChem CID 164596902) has the molecular formula C24H26BrClFN5O4 and a molecular weight of 582.86 g/mol. Its IUPAC name is tert-butyl (4R,7R,11R)-11-(aminomethyl)-17-bromo-18-chloro-16-fluoro-4-methyl-8-(oxomethylidene)-12-oxa-2,5,9,14-tetrazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(21),13,15,17,19-pentaene-5-carboxylate.
| Compound Name | tert-butyl (4R,7R,11R)-11-(aminomethyl)-17-bromo-18-chloro-16-fluoro-4-methyl-8-(oxomethylidene)-12-oxa-2,5,9,14-tetrazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(21),13,15,17,19-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 164596902 |
| Molecular Formula | C24H26BrClFN5O4 |
| Molecular Weight | 582.86 g/mol |
| Exact Mass | 581.08 |
| IUPAC Name | tert-butyl (4R,7R,11R)-11-(aminomethyl)-17-bromo-18-chloro-16-fluoro-4-methyl-8-(oxomethylidene)-12-oxa-2,5,9,14-tetrazapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(21),13,15,17,19-pentaene-5-carboxylate |
| SMILES | C[C@@H]1CN2c3c4c(nc5c(F)c(Br)c(Cl)cc35)O[C@H](CN)CN4C(=C=O)[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H26BrClFN5O4/c1-11-7-31-15(9-30(11)23(34)36-24(2,3)4)16(10-33)32-8-12(6-28)35-22-21(32)20(31)13-5-14(26)17(25)18(27)19(13)29-22/h5,11-12,15H,6-9,28H2,1-4H3/t11-,12-,15-/m1/s1 |
| InChIKey | YXSVLXXAHCSHSI-LALPHHSUSA-N |
| XLogP | 3.86 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.86 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|