About ethane;2-fluoro-1-methyl-4-nitrobenzene;1-nitro-2-(trifluoromethyl)benzene
ethane;2-fluoro-1-methyl-4-nitrobenzene;1-nitro-2-(trifluoromethyl)benzene (PubChem CID 164597116) has the molecular formula C16H16F4N2O4
and a molecular weight of 376.31 g/mol. Its IUPAC name is ethane;2-fluoro-1-methyl-4-nitrobenzene;1-nitro-2-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | ethane;2-fluoro-1-methyl-4-nitrobenzene;1-nitro-2-(trifluoromethyl)benzene |
| PubChem CID | 164597116 |
| Molecular Formula | C16H16F4N2O4 |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | ethane;2-fluoro-1-methyl-4-nitrobenzene;1-nitro-2-(trifluoromethyl)benzene |
| SMILES | CC.Cc1ccc([N+](=O)[O-])cc1F.O=[N+]([O-])c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C7H4F3NO2.C7H6FNO2.C2H6/c8-7(9,10)5-3-1-2-4-6(5)11(12)13;1-5-2-3-6(9(10)11)4-7(5)8;1-2/h1-4H;2-4H,1H3;1-2H3 |
| InChIKey | GNPBIXIDPVVZBV-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-fluoro-1-methyl-4-nitrobenzene;1-nitro-2-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-fluoro-1-methyl-4-nitrobenzene;1-nitro-2-(trifluoromethyl)benzene?
The IUPAC name of ethane;2-fluoro-1-methyl-4-nitrobenzene;1-nitro-2-(trifluoromethyl)benzene (CID 164597116) is ethane;2-fluoro-1-methyl-4-nitrobenzene;1-nitro-2-(trifluoromethyl)benzene.
What is the SMILES notation for ethane;2-fluoro-1-methyl-4-nitrobenzene;1-nitro-2-(trifluoromethyl)benzene?
The canonical SMILES for ethane;2-fluoro-1-methyl-4-nitrobenzene;1-nitro-2-(trifluoromethyl)benzene is CC.Cc1ccc([N+](=O)[O-])cc1F.O=[N+]([O-])c1ccccc1C(F)(F)F.
What is the InChIKey of ethane;2-fluoro-1-methyl-4-nitrobenzene;1-nitro-2-(trifluoromethyl)benzene?
The InChIKey is GNPBIXIDPVVZBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F3NO2.C7H6FNO2.C2H6/c8-7(9,10)5-3-1-2-4-6(5)11(12)13;1-5-2-3-6(9(10)11)4-7(5)8;1-2/h1-4H;2-4H,1H3;1-2H3.
What are the key properties of ethane;2-fluoro-1-methyl-4-nitrobenzene;1-nitro-2-(trifluoromethyl)benzene?
ethane;2-fluoro-1-methyl-4-nitrobenzene;1-nitro-2-(trifluoromethyl)benzene has a molecular weight of 376.31 g/mol, XLogP of 5.68, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-fluoro-1-methyl-4-nitrobenzene;1-nitro-2-(trifluoromethyl)benzene is sourced from PubChem (CID 164597116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).