C26H37FO5S — CID 164597206
3-[3-(3-fluoro-4-hexyl-2-oxochromen-5-yl)sulfanylpropoxy]propyl 2-methylbutanoate (PubChem CID 164597206) has the molecular formula C26H37FO5S and a molecular weight of 480.64 g/mol. Its IUPAC name is 3-[3-(3-fluoro-4-hexyl-2-oxochromen-5-yl)sulfanylpropoxy]propyl 2-methylbutanoate.
| Compound Name | 3-[3-(3-fluoro-4-hexyl-2-oxochromen-5-yl)sulfanylpropoxy]propyl 2-methylbutanoate |
|---|---|
| PubChem CID | 164597206 |
| Molecular Formula | C26H37FO5S |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 3-[3-(3-fluoro-4-hexyl-2-oxochromen-5-yl)sulfanylpropoxy]propyl 2-methylbutanoate |
| SMILES | CCCCCCc1c(F)c(=O)oc2cccc(SCCCOCCCOC(=O)C(C)CC)c12 |
| InChI | InChI=1S/C26H37FO5S/c1-4-6-7-8-12-20-23-21(32-26(29)24(20)27)13-9-14-22(23)33-18-11-16-30-15-10-17-31-25(28)19(3)5-2/h9,13-14,19H,4-8,10-12,15-18H2,1-3H3 |
| InChIKey | ZCCYFBBNYJRVFL-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|