C15H17F3O2S — CID 57324192
[2-cyclopentyl-3-(trifluoromethylsulfanyl)phenyl] propanoate (PubChem CID 57324192) has the molecular formula C15H17F3O2S and a molecular weight of 318.36 g/mol. Its IUPAC name is [2-cyclopentyl-3-(trifluoromethylsulfanyl)phenyl] propanoate.
| Compound Name | [2-cyclopentyl-3-(trifluoromethylsulfanyl)phenyl] propanoate |
|---|---|
| PubChem CID | 57324192 |
| Molecular Formula | C15H17F3O2S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | [2-cyclopentyl-3-(trifluoromethylsulfanyl)phenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(SC(F)(F)F)c1C1CCCC1 |
| InChI | InChI=1S/C15H17F3O2S/c1-2-13(19)20-11-8-5-9-12(21-15(16,17)18)14(11)10-6-3-4-7-10/h5,8-10H,2-4,6-7H2,1H3 |
| InChIKey | IHYSSBZWISVXMV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|