C18H19F3O3S3 — CID 164597225
2-[2-[4-methyl-2-sulfanylidene-3-(trifluoromethyl)chromen-6-yl]sulfanylethylsulfanyl]ethyl propanoate (PubChem CID 164597225) has the molecular formula C18H19F3O3S3 and a molecular weight of 436.54 g/mol. Its IUPAC name is 2-[2-[4-methyl-2-sulfanylidene-3-(trifluoromethyl)chromen-6-yl]sulfanylethylsulfanyl]ethyl propanoate.
| Compound Name | 2-[2-[4-methyl-2-sulfanylidene-3-(trifluoromethyl)chromen-6-yl]sulfanylethylsulfanyl]ethyl propanoate |
|---|---|
| PubChem CID | 164597225 |
| Molecular Formula | C18H19F3O3S3 |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 2-[2-[4-methyl-2-sulfanylidene-3-(trifluoromethyl)chromen-6-yl]sulfanylethylsulfanyl]ethyl propanoate |
| SMILES | CCC(=O)OCCSCCSc1ccc2oc(=S)c(C(F)(F)F)c(C)c2c1 |
| InChI | InChI=1S/C18H19F3O3S3/c1-3-15(22)23-6-7-26-8-9-27-12-4-5-14-13(10-12)11(2)16(17(25)24-14)18(19,20)21/h4-5,10H,3,6-9H2,1-2H3 |
| InChIKey | BQPUDFIOBMBFPD-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|