C18H17F3O6S — CID 164597305
2-[2-[4-methyl-2-oxo-3-(trifluoromethoxy)thiochromen-8-yl]oxyethoxy]ethyl prop-2-enoate (PubChem CID 164597305) has the molecular formula C18H17F3O6S and a molecular weight of 418.39 g/mol. Its IUPAC name is 2-[2-[4-methyl-2-oxo-3-(trifluoromethoxy)thiochromen-8-yl]oxyethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-[4-methyl-2-oxo-3-(trifluoromethoxy)thiochromen-8-yl]oxyethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 164597305 |
| Molecular Formula | C18H17F3O6S |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 2-[2-[4-methyl-2-oxo-3-(trifluoromethoxy)thiochromen-8-yl]oxyethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCOc1cccc2c(C)c(OC(F)(F)F)c(=O)sc12 |
| InChI | InChI=1S/C18H17F3O6S/c1-3-14(22)26-10-8-24-7-9-25-13-6-4-5-12-11(2)15(27-18(19,20)21)17(23)28-16(12)13/h3-6H,1,7-10H2,2H3 |
| InChIKey | JJFOUBABZDLNGC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|