C11H6F3NOS2 — CID 164599486
(5Z)-5-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-oxazolidine-2,4-dithione (PubChem CID 164599486) has the molecular formula C11H6F3NOS2 and a molecular weight of 289.30 g/mol. Its IUPAC name is (5Z)-5-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-oxazolidine-2,4-dithione.
| Compound Name | (5Z)-5-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-oxazolidine-2,4-dithione |
|---|---|
| PubChem CID | 164599486 |
| Molecular Formula | C11H6F3NOS2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | (5Z)-5-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-oxazolidine-2,4-dithione |
| SMILES | FC(F)(F)c1cccc(/C=C2\OC(=S)NC2=S)c1 |
| InChI | InChI=1S/C11H6F3NOS2/c12-11(13,14)7-3-1-2-6(4-7)5-8-9(17)15-10(18)16-8/h1-5H,(H,15,17,18)/b8-5- |
| InChIKey | KDHUSAIWCMOBBR-YVMONPNESA-N |
| XLogP | 3.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|