C35H34Cl2N8O2Si — CID 164600230
4-[tert-butyl(diphenyl)silyl]oxy-11-chloro-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide (PubChem CID 164600230) has the molecular formula C35H34Cl2N8O2Si and a molecular weight of 697.70 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxy-11-chloro-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxy-11-chloro-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 164600230 |
| Molecular Formula | C35H34Cl2N8O2Si |
| Molecular Weight | 697.70 g/mol |
| Exact Mass | 696.20 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxy-11-chloro-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3,3-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
| SMILES | CC1(C)c2c(cnc3cc(Cl)nn23)C(C(=O)Nc2cnc(-n3nccn3)c(Cl)c2)C1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H34Cl2N8O2Si/c1-34(2,3)48(23-12-8-6-9-13-23,24-14-10-7-11-15-24)47-31-29(25-21-38-28-19-27(37)43-44(28)30(25)35(31,4)5)33(46)42-22-18-26(36)32(39-20-22)45-40-16-17-41-45/h6-21,29,31H,1-5H3,(H,42,46) |
| InChIKey | JJKWNQMFEMZTBQ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.70 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|