C22H23Cl3N8O2 — CID 168891289
11-chloro-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3,3-dimethyl-4-oxa-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide;chloromethane;prop-1-ene (PubChem CID 168891289) has the molecular formula C22H23Cl3N8O2 and a molecular weight of 537.84 g/mol. Its IUPAC name is 11-chloro-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3,3-dimethyl-4-oxa-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide;chloromethane;prop-1-ene.
| Compound Name | 11-chloro-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3,3-dimethyl-4-oxa-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide;chloromethane;prop-1-ene |
|---|---|
| PubChem CID | 168891289 |
| Molecular Formula | C22H23Cl3N8O2 |
| Molecular Weight | 537.84 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | 11-chloro-N-[5-chloro-6-(triazol-2-yl)-3-pyridinyl]-3,3-dimethyl-4-oxa-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide;chloromethane;prop-1-ene |
| SMILES | C=CC.CC1(C)OC(C(=O)Nc2cnc(-n3nccn3)c(Cl)c2)c2cnc3cc(Cl)nn3c21.CCl |
| InChI | InChI=1S/C18H14Cl2N8O2.C3H6.CH3Cl/c1-18(2)15-10(8-21-13-6-12(20)26-27(13)15)14(30-18)17(29)25-9-5-11(19)16(22-7-9)28-23-3-4-24-28;1-3-2;1-2/h3-8,14H,1-2H3,(H,25,29);3H,1H2,2H3;1H3 |
| InChIKey | BKRBGDTXDGUMCT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.84 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|