C25H17N3O2 — CID 164601178
methyl 4-[[6-ethynyl-2-(4-ethynylphenyl)imidazo[1,2-a]pyridin-3-yl]amino]benzoate (PubChem CID 164601178) has the molecular formula C25H17N3O2 and a molecular weight of 391.43 g/mol. Its IUPAC name is methyl 4-[[6-ethynyl-2-(4-ethynylphenyl)imidazo[1,2-a]pyridin-3-yl]amino]benzoate.
| Compound Name | methyl 4-[[6-ethynyl-2-(4-ethynylphenyl)imidazo[1,2-a]pyridin-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 164601178 |
| Molecular Formula | C25H17N3O2 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | methyl 4-[[6-ethynyl-2-(4-ethynylphenyl)imidazo[1,2-a]pyridin-3-yl]amino]benzoate |
| SMILES | C#Cc1ccc(-c2nc3ccc(C#C)cn3c2Nc2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C25H17N3O2/c1-4-17-6-9-19(10-7-17)23-24(28-16-18(5-2)8-15-22(28)27-23)26-21-13-11-20(12-14-21)25(29)30-3/h1-2,6-16,26H,3H3 |
| InChIKey | FQDISWNSSWVFKI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|