C33H34ClN4O3Si — CID 164602397
CID 164602397 (PubChem CID 164602397) has the molecular formula C33H34ClN4O3Si and a molecular weight of 598.20 g/mol.
| Compound Name | CID 164602397 |
|---|---|
| PubChem CID | 164602397 |
| Molecular Formula | C33H34ClN4O3Si |
| Molecular Weight | 598.20 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | — |
| SMILES | Cc1ccc(N(C)c2cccc(CC3=CCN(Cc4nc5ccc(C(=O)O)cc5n4C[C@]4([Si])CCO4)CC3)c2)c(Cl)c1 |
| InChI | InChI=1S/C33H34ClN4O3Si/c1-22-6-9-29(27(34)16-22)36(2)26-5-3-4-24(18-26)17-23-10-13-37(14-11-23)20-31-35-28-8-7-25(32(39)40)19-30(28)38(31)21-33(42)12-15-41-33/h3-10,16,18-19H,11-15,17,20-21H2,1-2H3,(H,39,40)/t33-/m1/s1 |
| InChIKey | FNUVQOVVMIHUCQ-MGBGTMOVSA-N |
| XLogP | 6.12 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.20 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|