C15H15FN4O — CID 164602573
7-fluoro-N-(oxan-4-yl)pyrimido[1,6-b]indazol-3-amine (PubChem CID 164602573) has the molecular formula C15H15FN4O and a molecular weight of 286.31 g/mol. Its IUPAC name is 7-fluoro-N-(oxan-4-yl)pyrimido[1,6-b]indazol-3-amine.
| Compound Name | 7-fluoro-N-(oxan-4-yl)pyrimido[1,6-b]indazol-3-amine |
|---|---|
| PubChem CID | 164602573 |
| Molecular Formula | C15H15FN4O |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 7-fluoro-N-(oxan-4-yl)pyrimido[1,6-b]indazol-3-amine |
| SMILES | Fc1ccc2c(c1)nn1cnc(NC3CCOCC3)cc21 |
| InChI | InChI=1S/C15H15FN4O/c16-10-1-2-12-13(7-10)19-20-9-17-15(8-14(12)20)18-11-3-5-21-6-4-11/h1-2,7-9,11,18H,3-6H2 |
| InChIKey | DSZUFNBVIHIDBK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |