C15H16FN5 — CID 164602600
7-fluoro-N-piperidin-4-ylpyrimido[1,6-b]indazol-3-amine (PubChem CID 164602600) has the molecular formula C15H16FN5 and a molecular weight of 285.33 g/mol. Its IUPAC name is 7-fluoro-N-piperidin-4-ylpyrimido[1,6-b]indazol-3-amine.
| Compound Name | 7-fluoro-N-piperidin-4-ylpyrimido[1,6-b]indazol-3-amine |
|---|---|
| PubChem CID | 164602600 |
| Molecular Formula | C15H16FN5 |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 7-fluoro-N-piperidin-4-ylpyrimido[1,6-b]indazol-3-amine |
| SMILES | Fc1ccc2c(c1)nn1cnc(NC3CCNCC3)cc21 |
| InChI | InChI=1S/C15H16FN5/c16-10-1-2-12-13(7-10)20-21-9-18-15(8-14(12)21)19-11-3-5-17-6-4-11/h1-2,7-9,11,17,19H,3-6H2 |
| InChIKey | RKXZTRKPOCNZPZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |