C12H14F2 — CID 164603434
5,6-difluoro-1,2,3,4-tetrahydronaphthalene;ethene (PubChem CID 164603434) has the molecular formula C12H14F2 and a molecular weight of 196.24 g/mol. Its IUPAC name is 5,6-difluoro-1,2,3,4-tetrahydronaphthalene;ethene.
| Compound Name | 5,6-difluoro-1,2,3,4-tetrahydronaphthalene;ethene |
|---|---|
| PubChem CID | 164603434 |
| Molecular Formula | C12H14F2 |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 5,6-difluoro-1,2,3,4-tetrahydronaphthalene;ethene |
| SMILES | C=C.Fc1ccc2c(c1F)CCCC2 |
| InChI | InChI=1S/C10H10F2.C2H4/c11-9-6-5-7-3-1-2-4-8(7)10(9)12;1-2/h5-6H,1-4H2;1-2H2 |
| InChIKey | RAWGTVZONFPCRH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|