C28H30F4N6O3 — CID 164608198
N-[4-fluoro-5-[1-(1,3-oxazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carboxamide (PubChem CID 164608198) has the molecular formula C28H30F4N6O3 and a molecular weight of 574.58 g/mol. Its IUPAC name is N-[4-fluoro-5-[1-(1,3-oxazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carboxamide.
| Compound Name | N-[4-fluoro-5-[1-(1,3-oxazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164608198 |
| Molecular Formula | C28H30F4N6O3 |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | N-[4-fluoro-5-[1-(1,3-oxazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-3H-pyridine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(F)c(C3=CCCN(c4ncco4)C3)cc2NC(=O)C2C=NC(=O)C=C2C(F)(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C28H30F4N6O3/c1-16-13-38(14-17(2)36(16)3)24-11-22(29)19(18-5-4-7-37(15-18)27-33-6-8-41-27)9-23(24)35-26(40)20-12-34-25(39)10-21(20)28(30,31)32/h5-6,8-12,16-17,20H,4,7,13-15H2,1-3H3,(H,35,40)/t16-,17+,20? |
| InChIKey | HRKFWSXAUAQVFP-XEWABKELSA-N |
| XLogP | 4.29 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|