C16H23N5O3S — CID 164609264
2-[1-[(3,5-diethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-yl]oxypyrazine (PubChem CID 164609264) has the molecular formula C16H23N5O3S and a molecular weight of 365.46 g/mol. Its IUPAC name is 2-[1-[(3,5-diethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-yl]oxypyrazine.
| Compound Name | 2-[1-[(3,5-diethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-yl]oxypyrazine |
|---|---|
| PubChem CID | 164609264 |
| Molecular Formula | C16H23N5O3S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-[1-[(3,5-diethyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-yl]oxypyrazine |
| SMILES | CCc1n[nH]c(CC)c1S(=O)(=O)N1CCC(Oc2cnccn2)CC1 |
| InChI | InChI=1S/C16H23N5O3S/c1-3-13-16(14(4-2)20-19-13)25(22,23)21-9-5-12(6-10-21)24-15-11-17-7-8-18-15/h7-8,11-12H,3-6,9-10H2,1-2H3,(H,19,20) |
| InChIKey | QLSHOCULYCUXAT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |