C15H21N5O3S — CID 164625321
2-[1-[(3-ethyl-5-methyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-yl]oxypyrazine (PubChem CID 164625321) has the molecular formula C15H21N5O3S and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-[1-[(3-ethyl-5-methyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-yl]oxypyrazine.
| Compound Name | 2-[1-[(3-ethyl-5-methyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-yl]oxypyrazine |
|---|---|
| PubChem CID | 164625321 |
| Molecular Formula | C15H21N5O3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-[1-[(3-ethyl-5-methyl-1H-pyrazol-4-yl)sulfonyl]piperidin-4-yl]oxypyrazine |
| SMILES | CCc1n[nH]c(C)c1S(=O)(=O)N1CCC(Oc2cnccn2)CC1 |
| InChI | InChI=1S/C15H21N5O3S/c1-3-13-15(11(2)18-19-13)24(21,22)20-8-4-12(5-9-20)23-14-10-16-6-7-17-14/h6-7,10,12H,3-5,8-9H2,1-2H3,(H,18,19) |
| InChIKey | PGQHUQMDIDORKG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |