C28H26N6O4 — CID 164609503
3-acetyl-7-[[4-(2,3-dimethylindazol-5-yl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one (PubChem CID 164609503) has the molecular formula C28H26N6O4 and a molecular weight of 510.55 g/mol. Its IUPAC name is 3-acetyl-7-[[4-(2,3-dimethylindazol-5-yl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one.
| Compound Name | 3-acetyl-7-[[4-(2,3-dimethylindazol-5-yl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one |
|---|---|
| PubChem CID | 164609503 |
| Molecular Formula | C28H26N6O4 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 3-acetyl-7-[[4-(2,3-dimethylindazol-5-yl)pyrimidin-2-yl]amino]-4-morpholin-4-ylchromen-2-one |
| SMILES | CC(=O)c1c(N2CCOCC2)c2ccc(Nc3nccc(-c4ccc5nn(C)c(C)c5c4)n3)cc2oc1=O |
| InChI | InChI=1S/C28H26N6O4/c1-16-21-14-18(4-7-23(21)32-33(16)3)22-8-9-29-28(31-22)30-19-5-6-20-24(15-19)38-27(36)25(17(2)35)26(20)34-10-12-37-13-11-34/h4-9,14-15H,10-13H2,1-3H3,(H,29,30,31) |
| InChIKey | JMXKUBXNZGHANG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|