C25H24N6O — CID 164609521
7-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-N-[2-(furan-3-yl)-4-pyridinyl]quinolin-4-amine (PubChem CID 164609521) has the molecular formula C25H24N6O and a molecular weight of 424.51 g/mol. Its IUPAC name is 7-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-N-[2-(furan-3-yl)-4-pyridinyl]quinolin-4-amine.
| Compound Name | 7-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-N-[2-(furan-3-yl)-4-pyridinyl]quinolin-4-amine |
|---|---|
| PubChem CID | 164609521 |
| Molecular Formula | C25H24N6O |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 7-[1-[2-(dimethylamino)ethyl]pyrazol-4-yl]-N-[2-(furan-3-yl)-4-pyridinyl]quinolin-4-amine |
| SMILES | CN(C)CCn1cc(-c2ccc3c(Nc4ccnc(-c5ccoc5)c4)ccnc3c2)cn1 |
| InChI | InChI=1S/C25H24N6O/c1-30(2)10-11-31-16-20(15-28-31)18-3-4-22-23(6-9-27-25(22)13-18)29-21-5-8-26-24(14-21)19-7-12-32-17-19/h3-9,12-17H,10-11H2,1-2H3,(H,26,27,29) |
| InChIKey | ULMJOBGKUKPBKO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |