C22H26ClN3O — CID 164609529
5-chloro-2-methyl-2-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3H-inden-1-one (PubChem CID 164609529) has the molecular formula C22H26ClN3O and a molecular weight of 383.92 g/mol. Its IUPAC name is 5-chloro-2-methyl-2-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3H-inden-1-one.
| Compound Name | 5-chloro-2-methyl-2-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3H-inden-1-one |
|---|---|
| PubChem CID | 164609529 |
| Molecular Formula | C22H26ClN3O |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 5-chloro-2-methyl-2-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3H-inden-1-one |
| SMILES | CC1(CCCN2CCN(c3ccccn3)CC2)Cc2cc(Cl)ccc2C1=O |
| InChI | InChI=1S/C22H26ClN3O/c1-22(16-17-15-18(23)6-7-19(17)21(22)27)8-4-10-25-11-13-26(14-12-25)20-5-2-3-9-24-20/h2-3,5-7,9,15H,4,8,10-14,16H2,1H3 |
| InChIKey | AKXPLUFJRRUGNE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |