C13H13Br2ClN2 — CID 164610341
5,7-dibromo-1,2,3,4-tetrahydroacridin-9-amine;hydrochloride (PubChem CID 164610341) has the molecular formula C13H13Br2ClN2 and a molecular weight of 392.52 g/mol. Its IUPAC name is 5,7-dibromo-1,2,3,4-tetrahydroacridin-9-amine;hydrochloride.
| Compound Name | 5,7-dibromo-1,2,3,4-tetrahydroacridin-9-amine;hydrochloride |
|---|---|
| PubChem CID | 164610341 |
| Molecular Formula | C13H13Br2ClN2 |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 389.91 |
| IUPAC Name | 5,7-dibromo-1,2,3,4-tetrahydroacridin-9-amine;hydrochloride |
| SMILES | Cl.Nc1c2c(nc3c(Br)cc(Br)cc13)CCCC2 |
| InChI | InChI=1S/C13H12Br2N2.ClH/c14-7-5-9-12(16)8-3-1-2-4-11(8)17-13(9)10(15)6-7;/h5-6H,1-4H2,(H2,16,17);1H |
| InChIKey | KJLCMEJEGPBNIW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |