C28H22N2O5 — CID 164610504
methyl 5-[3-[[4-[(E)-3-(2-methylphenyl)-3-oxoprop-1-enyl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate (PubChem CID 164610504) has the molecular formula C28H22N2O5 and a molecular weight of 466.49 g/mol. Its IUPAC name is methyl 5-[3-[[4-[(E)-3-(2-methylphenyl)-3-oxoprop-1-enyl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate.
| Compound Name | methyl 5-[3-[[4-[(E)-3-(2-methylphenyl)-3-oxoprop-1-enyl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 164610504 |
| Molecular Formula | C28H22N2O5 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | methyl 5-[3-[[4-[(E)-3-(2-methylphenyl)-3-oxoprop-1-enyl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2cccc(NC(=O)c3ccc(/C=C/C(=O)c4ccccc4C)cc3)c2)on1 |
| InChI | InChI=1S/C28H22N2O5/c1-18-6-3-4-9-23(18)25(31)15-12-19-10-13-20(14-11-19)27(32)29-22-8-5-7-21(16-22)26-17-24(30-35-26)28(33)34-2/h3-17H,1-2H3,(H,29,32)/b15-12+ |
| InChIKey | RKGVBGJYDODQPE-NTCAYCPXSA-N |
| XLogP | 5.59 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|