C27H18F2N2O5 — CID 164610581
methyl 5-[3-[[4-[(E)-3-(2,4-difluorophenyl)-3-oxoprop-1-enyl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate (PubChem CID 164610581) has the molecular formula C27H18F2N2O5 and a molecular weight of 488.45 g/mol. Its IUPAC name is methyl 5-[3-[[4-[(E)-3-(2,4-difluorophenyl)-3-oxoprop-1-enyl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate.
| Compound Name | methyl 5-[3-[[4-[(E)-3-(2,4-difluorophenyl)-3-oxoprop-1-enyl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 164610581 |
| Molecular Formula | C27H18F2N2O5 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | methyl 5-[3-[[4-[(E)-3-(2,4-difluorophenyl)-3-oxoprop-1-enyl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2cccc(NC(=O)c3ccc(/C=C/C(=O)c4ccc(F)cc4F)cc3)c2)on1 |
| InChI | InChI=1S/C27H18F2N2O5/c1-35-27(34)23-15-25(36-31-23)18-3-2-4-20(13-18)30-26(33)17-8-5-16(6-9-17)7-12-24(32)21-11-10-19(28)14-22(21)29/h2-15H,1H3,(H,30,33)/b12-7+ |
| InChIKey | FUOODJGRFHHTMA-KPKJPENVSA-N |
| XLogP | 5.55 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|