C27H19ClN2O6 — CID 164629086
methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate (PubChem CID 164629086) has the molecular formula C27H19ClN2O6 and a molecular weight of 502.91 g/mol. Its IUPAC name is methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate.
| Compound Name | methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 164629086 |
| Molecular Formula | C27H19ClN2O6 |
| Molecular Weight | 502.91 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2cccc(NC(=O)c3ccc(C4OC4C(=O)c4ccc(Cl)cc4)cc3)c2)on1 |
| InChI | InChI=1S/C27H19ClN2O6/c1-34-27(33)21-14-22(36-30-21)18-3-2-4-20(13-18)29-26(32)17-7-5-16(6-8-17)24-25(35-24)23(31)15-9-11-19(28)12-10-15/h2-14,24-25H,1H3,(H,29,32) |
| InChIKey | BGEHUVLTVONRFO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.91 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|