About methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate
methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate (PubChem CID 164629086) has the molecular formula C27H19ClN2O6
and a molecular weight of 502.91 g/mol. Its IUPAC name is methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate |
| PubChem CID | 164629086 |
| Molecular Formula | C27H19ClN2O6 |
| Molecular Weight | 502.91 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2cccc(NC(=O)c3ccc(C4OC4C(=O)c4ccc(Cl)cc4)cc3)c2)on1 |
| InChI | InChI=1S/C27H19ClN2O6/c1-34-27(33)21-14-22(36-30-21)18-3-2-4-20(13-18)29-26(32)17-7-5-16(6-8-17)24-25(35-24)23(31)15-9-11-19(28)12-10-15/h2-14,24-25H,1H3,(H,29,32) |
| InChIKey | BGEHUVLTVONRFO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.91 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate?
The IUPAC name of methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate (CID 164629086) is methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate.
What is the SMILES notation for methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate?
The canonical SMILES for methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate is COC(=O)c1cc(-c2cccc(NC(=O)c3ccc(C4OC4C(=O)c4ccc(Cl)cc4)cc3)c2)on1.
What is the InChIKey of methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate?
The InChIKey is BGEHUVLTVONRFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H19ClN2O6/c1-34-27(33)21-14-22(36-30-21)18-3-2-4-20(13-18)29-26(32)17-7-5-16(6-8-17)24-25(35-24)23(31)15-9-11-19(28)12-10-15/h2-14,24-25H,1H3,(H,29,32).
What are the key properties of methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate?
methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate has a molecular weight of 502.91 g/mol, XLogP of 5.36, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[3-[[4-[3-(4-chlorobenzoyl)oxiran-2-yl]benzoyl]amino]phenyl]-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 164629086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).