C22H21N3O2Se — CID 164610819
7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(4-methylphenyl)pyrazolo[1,5-a]pyrazine (PubChem CID 164610819) has the molecular formula C22H21N3O2Se and a molecular weight of 438.39 g/mol. Its IUPAC name is 7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(4-methylphenyl)pyrazolo[1,5-a]pyrazine.
| Compound Name | 7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(4-methylphenyl)pyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 164610819 |
| Molecular Formula | C22H21N3O2Se |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 7-(3,4-dimethoxy-5-methylselanylphenyl)-2-(4-methylphenyl)pyrazolo[1,5-a]pyrazine |
| SMILES | COc1cc(-c2cncc3cc(-c4ccc(C)cc4)nn23)cc([Se]C)c1OC |
| InChI | InChI=1S/C22H21N3O2Se/c1-14-5-7-15(8-6-14)18-11-17-12-23-13-19(25(17)24-18)16-9-20(26-2)22(27-3)21(10-16)28-4/h5-13H,1-4H3 |
| InChIKey | RZGFUBHJVPMXMJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|