C21H29N3O2 — CID 164611070
cyclopropyl-[4-[1-(3-methylbutyl)benzimidazol-2-yl]oxypiperidin-1-yl]methanone (PubChem CID 164611070) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is cyclopropyl-[4-[1-(3-methylbutyl)benzimidazol-2-yl]oxypiperidin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-[1-(3-methylbutyl)benzimidazol-2-yl]oxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 164611070 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | cyclopropyl-[4-[1-(3-methylbutyl)benzimidazol-2-yl]oxypiperidin-1-yl]methanone |
| SMILES | CC(C)CCn1c(OC2CCN(C(=O)C3CC3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C21H29N3O2/c1-15(2)9-14-24-19-6-4-3-5-18(19)22-21(24)26-17-10-12-23(13-11-17)20(25)16-7-8-16/h3-6,15-17H,7-14H2,1-2H3 |
| InChIKey | ITLHIPUAZADETN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |