C25H24N2O5S — CID 164611615
methyl 4-[[2-[1-(benzenesulfonyl)indol-4-yl]oxyethylamino]methyl]benzoate (PubChem CID 164611615) has the molecular formula C25H24N2O5S and a molecular weight of 464.54 g/mol. Its IUPAC name is methyl 4-[[2-[1-(benzenesulfonyl)indol-4-yl]oxyethylamino]methyl]benzoate.
| Compound Name | methyl 4-[[2-[1-(benzenesulfonyl)indol-4-yl]oxyethylamino]methyl]benzoate |
|---|---|
| PubChem CID | 164611615 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | methyl 4-[[2-[1-(benzenesulfonyl)indol-4-yl]oxyethylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNCCOc2cccc3c2ccn3S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N2O5S/c1-31-25(28)20-12-10-19(11-13-20)18-26-15-17-32-24-9-5-8-23-22(24)14-16-27(23)33(29,30)21-6-3-2-4-7-21/h2-14,16,26H,15,17-18H2,1H3 |
| InChIKey | IJUVLRQDHNRBCW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|