C14H20Cl2N2O2 — CID 164613441
2-[(E)-[1-(3,4-dichlorophenyl)-5-methoxypentylidene]amino]oxyethanamine (PubChem CID 164613441) has the molecular formula C14H20Cl2N2O2 and a molecular weight of 319.23 g/mol. Its IUPAC name is 2-[(E)-[1-(3,4-dichlorophenyl)-5-methoxypentylidene]amino]oxyethanamine.
| Compound Name | 2-[(E)-[1-(3,4-dichlorophenyl)-5-methoxypentylidene]amino]oxyethanamine |
|---|---|
| PubChem CID | 164613441 |
| Molecular Formula | C14H20Cl2N2O2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-[(E)-[1-(3,4-dichlorophenyl)-5-methoxypentylidene]amino]oxyethanamine |
| SMILES | COCCCC/C(=N\OCCN)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H20Cl2N2O2/c1-19-8-3-2-4-14(18-20-9-7-17)11-5-6-12(15)13(16)10-11/h5-6,10H,2-4,7-9,17H2,1H3/b18-14+ |
| InChIKey | GHPBECDJKSNKHX-NBVRZTHBSA-N |
| XLogP | 3.49 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|