C12H14Cl2N2O3 — CID 44622394
(4Z)-4-(2-aminoethoxyimino)-4-(3,4-dichlorophenyl)butanoic acid (PubChem CID 44622394) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is (4Z)-4-(2-aminoethoxyimino)-4-(3,4-dichlorophenyl)butanoic acid.
| Compound Name | (4Z)-4-(2-aminoethoxyimino)-4-(3,4-dichlorophenyl)butanoic acid |
|---|---|
| PubChem CID | 44622394 |
| Molecular Formula | C12H14Cl2N2O3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | (4Z)-4-(2-aminoethoxyimino)-4-(3,4-dichlorophenyl)butanoic acid |
| SMILES | NCCO/N=C(/CCC(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N2O3/c13-9-2-1-8(7-10(9)14)11(3-4-12(17)18)16-19-6-5-15/h1-2,7H,3-6,15H2,(H,17,18)/b16-11- |
| InChIKey | TUJKGJWQAQEKOW-WJDWOHSUSA-N |
| XLogP | 2.54 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|